BIOPEP-UWM: Report
| ID | 11143 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 9 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 1033.0862 | Monoisotopic mass | 1032.4747 | |
| IC50 : | 1.57 µM |
|||
| Bibliographic data: | |
| Authors | |
| Magouz O., Ibrahim M. A. A., Mehanna N., Gensberger-Reigl S., Dalabasmaz S., Pischetsrieder M. | |
| Title | |
| Identification of the heptapeptide PR7 and octapeptide SF8 with potent antioxidative and angiotensin converting enzyme inhibitory activity from the fermented dairy by-product “Buttermilk". Food Front., 6, 837–851, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)O InChI=1S/C46H68N10O17/c1-23(2)36(54-38(64)26-11-7-19-48-26)43(69)50-28(15-18-35(62)63)45(71)56-20-8-12-32(56)42(68)52-30(21-25-9-5-4-6-10-25)40(66)55-37(24(3)58)44(70)49-27(14-17-34(60)61)39(65)53-31(22-57)41(67)51-29(46(72)73)13-16-33(47)59/h4-6,9-10,23-24,26-32,36-37,48,57-58H,7-8,11-22H2,1-3H3,(H2,47,59)(H,49,70)(H,50,69)(H,51,67)(H,52,68)(H,53,65)(H,54,64)(H,55,66)(H,60,61)(H,62,63)(H,72,73)/t24-,26+,27+,28+,29+,30+,31+,32+,36+,37+/m1/s1 InChIKey=QKVQFNSZBSARRA-OBALASBNSA-N |
| Database reference: |