BIOPEP-UWM: Report
| ID | 11146 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 7 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 757.8713 | Monoisotopic mass | 757.3997 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Magouz O., Ibrahim M. A. A., Mehanna N., Gensberger-Reigl S., Dalabasmaz S., Pischetsrieder M. | |
| Title | |
| Identification of the heptapeptide PR7 and octapeptide SF8 with potent antioxidative and angiotensin converting enzyme inhibitory activity from the fermented dairy by-product “Buttermilk". Food Front., 6, 837–851, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(C(C)C)C(=O)O InChI=1S/C37H55N7O10/c1-20(2)29(38)34(50)39-22(5)35(51)43-17-9-13-26(43)33(49)41-25(19-23-11-7-6-8-12-23)36(52)44-18-10-14-27(44)32(48)40-24(15-16-28(45)46)31(47)42-30(21(3)4)37(53)54/h6-8,11-12,20-22,24-27,29-30H,9-10,13-19,38H2,1-5H3,(H,39,50)(H,40,48)(H,41,49)(H,42,47)(H,45,46)(H,53,54)/t22-,24-,25-,26-,27-,29-,30-/m0/s1 InChIKey=NKBNJBMJISHPIG-KNWHVVHCSA-N |
| Database reference: |