BIOPEP-UWM: Report
| ID | 11150 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 10 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 1108.2417 | Monoisotopic mass | 1107.5905 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Magouz O., Ibrahim M. A. A., Mehanna N., Gensberger-Reigl S., Dalabasmaz S., Pischetsrieder M. | |
| Title | |
| Identification of the heptapeptide PR7 and octapeptide SF8 with potent antioxidative and angiotensin converting enzyme inhibitory activity from the fermented dairy by-product “Buttermilk". Food Front., 6, 837–851, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)O InChI=1S/C49H81N13O16/c1-7-24(4)37(58-44(72)31(22-36(52)67)56-41(69)28(14-16-34(50)65)54-40(68)27-11-8-18-53-27)48(76)62-20-10-13-33(62)47(75)61-19-9-12-32(61)45(73)57-30(21-23(2)3)43(71)59-38(25(5)63)46(74)55-29(15-17-35(51)66)42(70)60-39(26(6)64)49(77)78/h23-33,37-39,53,63-64H,7-22H2,1-6H3,(H2,50,65)(H2,51,66)(H2,52,67)(H,54,68)(H,55,74)(H,56,69)(H,57,73)(H,58,72)(H,59,71)(H,60,70)(H,77,78)/t24-,25+,26+,27-,28-,29-,30-,31-,32-,33-,37-,38-,39-/m0/s1 InChIKey=MWRRJEUXCOHNHI-FWINVJERSA-N |
| Database reference: |