BIOPEP-UWM: Report
| ID | 11157 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 10 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 1018.2069 | Monoisotopic mass | 1017.5953 | |
| IC50 : | 1.57 µM |
|||
| Bibliographic data: | |
| Authors | |
| Magouz O., Ibrahim M. A. A., Mehanna N., Gensberger-Reigl S., Dalabasmaz S., Pischetsrieder M. | |
| Title | |
| Identification of the heptapeptide PR7 and octapeptide SF8 with potent antioxidative and angiotensin converting enzyme inhibitory activity from the fermented dairy by-product “Buttermilk". Food Front., 6, 837–851, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(O)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C47H79N13O12/c1-25(2)22-30(55-41(66)32-13-8-19-58(32)43(68)31(23-26(3)4)56-42(67)34-15-10-21-60(34)45(70)37(48)28(6)61)39(64)53-27(5)38(63)52-24-36(62)57-18-11-16-35(57)44(69)59-20-9-14-33(59)40(65)54-29(46(71)72)12-7-17-51-47(49)50/h25-35,37,61H,7-24,48H2,1-6H3,(H,52,63)(H,53,64)(H,54,65)(H,55,66)(H,56,67)(H,71,72)(H4,49,50,51)/t27-,28+,29-,30-,31-,32-,33-,34-,35-,37-/m0/s1 InChIKey=MFEUJIZMZQSPBD-DMBNOETDSA-N |
| Database reference: |