BIOPEP-UWM: Report
| ID | 11162 |
| Name | Copper binding peptide |
| sequence |
| Function: | |||
| Copper binding | |||
| Number of residues | 6 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 651.7100 | Monoisotopic mass | 651.3330 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Camaño Echavarría J. A., Mathé C., Arnoux P., Stefan L., Paris C., Selmeczi K., Udenigwe C. C., Canabady-Rochelle L. | |
| Title | |
| Metal-chelating peptides derived from sunflower meal protein: preparation, isolation, identification, and antioxidant properties. ACS Food Sci. Technol., 5, 2336–2350, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CO)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)O InChI=1S/C28H45N9O9/c1-4-14(2)22(36-23(40)15(3)29)26(43)33-17(7-8-21(30)39)24(41)35-19(12-38)27(44)37-9-5-6-20(37)25(42)34-18(28(45)46)10-16-11-31-13-32-16/h11,13-15,17-20,22,38H,4-10,12,29H2,1-3H3,(H2,30,39)(H,31,32)(H,33,43)(H,34,42)(H,35,41)(H,36,40)(H,45,46)/t14-,15-,17-,18-,19-,20-,22-/m0/s1 InChIKey=ZGVIUGXLCOBZHK-NBENHSBMSA-N |
| Database reference: |