BIOPEP-UWM: Report
| ID | 11164 |
| Name | Copper binding peptide |
| sequence |
| Function: | |||
| Copper binding | |||
| Number of residues | 6 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 686.7573 | Monoisotopic mass | 686.3490 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Camaño Echavarría J. A., Mathé C., Arnoux P., Stefan L., Paris C., Selmeczi K., Udenigwe C. C., Canabady-Rochelle L. | |
| Title | |
| Metal-chelating peptides derived from sunflower meal protein: preparation, isolation, identification, and antioxidant properties. ACS Food Sci. Technol., 5, 2336–2350, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)O)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)O InChI=1S/C31H46N10O8/c1-3-17(2)25(41-28(46)22(12-18-8-5-4-6-9-18)39-26(44)20(32)14-24(42)43)29(47)38-21(10-7-11-36-31(33)34)27(45)40-23(30(48)49)13-19-15-35-16-37-19/h4-6,8-9,15-17,20-23,25H,3,7,10-14,32H2,1-2H3,(H,35,37)(H,38,47)(H,39,44)(H,40,45)(H,41,46)(H,42,43)(H,48,49)(H4,33,34,36)/t17-,20-,21-,22-,23-,25-/m0/s1 InChIKey=HIBLEACUYYYFOH-RYDHTMFISA-N |
| Database reference: |