BIOPEP-UWM: Report
| ID | 11165 |
| Name | Copper binding peptide |
| sequence |
| Function: | |||
| Copper binding | |||
| Number of residues | 7 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 868.0279 | Monoisotopic mass | 867.4839 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Camaño Echavarría J. A., Mathé C., Arnoux P., Stefan L., Paris C., Selmeczi K., Udenigwe C. C., Canabady-Rochelle L. | |
| Title | |
| Metal-chelating peptides derived from sunflower meal protein: preparation, isolation, identification, and antioxidant properties. ACS Food Sci. Technol., 5, 2336–2350, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C43H65N9O10/c1-7-26(6)36(51-40(58)34-14-11-17-52(34)42(60)29(44)20-27-12-9-8-10-13-27)41(59)49-31(18-24(2)3)38(56)47-30(15-16-35(53)54)37(55)48-32(21-28-22-45-23-46-28)39(57)50-33(43(61)62)19-25(4)5/h8-10,12-13,22-26,29-34,36H,7,11,14-21,44H2,1-6H3,(H,45,46)(H,47,56)(H,48,55)(H,49,59)(H,50,57)(H,51,58)(H,53,54)(H,61,62)/t26-,29-,30-,31-,32-,33-,34-,36-/m0/s1 InChIKey=SOJWNVIKQASTRH-ZUNOFDKRSA-N |
| Database reference: |