BIOPEP-UWM: Report
| ID | 11168 |
| Name | Copper binding peptide |
| sequence |
| Function: | |||
| Copper binding | |||
| Number of residues | 11 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 1285.3619 | Monoisotopic mass | 1284.6192 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Camaño Echavarría J. A., Mathé C., Arnoux P., Stefan L., Paris C., Selmeczi K., Udenigwe C. C., Canabady-Rochelle L. | |
| Title | |
| Metal-chelating peptides derived from sunflower meal protein: preparation, isolation, identification, and antioxidant properties. ACS Food Sci. Technol., 5, 2336–2350, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C55H84N18O18/c1-5-27(3)44(52(88)71-37(54(90)91)19-29-11-8-7-9-12-29)73-53(89)45(28(4)6-2)72-51(87)34(20-30-24-61-26-64-30)66-41(77)25-63-46(82)31(13-10-18-62-55(59)60)67-48(84)33(14-16-38(57)74)68-50(86)36(22-43(80)81)70-49(85)35(21-39(58)75)69-47(83)32(15-17-42(78)79)65-40(76)23-56/h7-9,11-12,24,26-28,31-37,44-45H,5-6,10,13-23,25,56H2,1-4H3,(H2,57,74)(H2,58,75)(H,61,64)(H,63,82)(H,65,76)(H,66,77)(H,67,84)(H,68,86)(H,69,83)(H,70,85)(H,71,88)(H,72,87)(H,73,89)(H,78,79)(H,80,81)(H,90,91)(H4,59,60,62)/t27-,28-,31-,32-,33-,34-,35-,36-,37-,44-,45-/m0/s1 InChIKey=FLWKINJCTZVXLA-OBQPGUIRSA-N |
| Database reference: |