BIOPEP-UWM: Report
| ID | 11170 |
| Name | Copper binding peptide |
| sequence |
| Function: | |||
| Copper binding | |||
| Number of residues | 10 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 1055.0967 | Monoisotopic mass | 1054.5027 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Camaño Echavarría J. A., Mathé C., Arnoux P., Stefan L., Paris C., Selmeczi K., Udenigwe C. C., Canabady-Rochelle L. | |
| Title | |
| Metal-chelating peptides derived from sunflower meal protein: preparation, isolation, identification, and antioxidant properties. ACS Food Sci. Technol., 5, 2336–2350, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)NCC(=O)N[C@@]([H])(CCC(=O)N)C(=O)O InChI=1S/C43H70N14O17/c1-5-20(3)34(56-31(62)14-44)41(71)55-28(18-59)40(70)54-27(17-58)39(69)51-24(9-12-33(64)65)37(67)53-26(13-22-15-47-19-49-22)38(68)57-35(21(4)6-2)42(72)52-23(7-10-29(45)60)36(66)48-16-32(63)50-25(43(73)74)8-11-30(46)61/h15,19-21,23-28,34-35,58-59H,5-14,16-18,44H2,1-4H3,(H2,45,60)(H2,46,61)(H,47,49)(H,48,66)(H,50,63)(H,51,69)(H,52,72)(H,53,67)(H,54,70)(H,55,71)(H,56,62)(H,57,68)(H,64,65)(H,73,74)/t20-,21-,23-,24-,25-,26-,27-,28-,34-,35-/m0/s1 InChIKey=GHNDDQKXGZLDMN-OQGAEZBQSA-N |
| Database reference: |