BIOPEP-UWM: Report
| ID | 11172 |
| Name | Copper binding peptide |
| sequence |
| Function: | |||
| Copper binding | |||
| Number of residues | 8 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 842.9392 | Monoisotopic mass | 842.4386 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Camaño Echavarría J. A., Mathé C., Arnoux P., Stefan L., Paris C., Selmeczi K., Udenigwe C. C., Canabady-Rochelle L. | |
| Title | |
| Metal-chelating peptides derived from sunflower meal protein: preparation, isolation, identification, and antioxidant properties. ACS Food Sci. Technol., 5, 2336–2350, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)O InChI=1S/C38H58N12O10/c1-5-21(4)31(36(58)45-24(12-9-13-43-38(40)41)32(54)48-27(37(59)60)15-23-18-42-19-44-23)50-34(56)25(14-22-10-7-6-8-11-22)46-33(55)26(16-29(52)53)47-35(57)30(20(2)3)49-28(51)17-39/h6-8,10-11,18-21,24-27,30-31H,5,9,12-17,39H2,1-4H3,(H,42,44)(H,45,58)(H,46,55)(H,47,57)(H,48,54)(H,49,51)(H,50,56)(H,52,53)(H,59,60)(H4,40,41,43)/t21-,24-,25-,26-,27-,30-,31-/m0/s1 InChIKey=OHUQDXITOUTVKH-DZBYZWQYSA-N |
| Database reference: |