BIOPEP-UWM: Report
| ID | 11176 |
| Name | Copper binding peptide |
| sequence |
| Function: | |||
| Copper binding | |||
| Number of residues | 4 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 486.5197 | Monoisotopic mass | 486.2220 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Camaño Echavarría J. A., Mathé C., Arnoux P., Stefan L., Paris C., Selmeczi K., Udenigwe C. C., Canabady-Rochelle L. | |
| Title | |
| Metal-chelating peptides derived from sunflower meal protein: preparation, isolation, identification, and antioxidant properties. ACS Food Sci. Technol., 5, 2336–2350, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(C)C(=O)O InChI=1S/C23H30N6O6/c1-13(23(34)35)27-21(32)18(9-14-4-6-16(30)7-5-14)28-22(33)19(10-15-11-24-12-26-15)29-20(31)17-3-2-8-25-17/h4-7,11-13,17-19,25,30H,2-3,8-10H2,1H3,(H,24,26)(H,27,32)(H,28,33)(H,29,31)(H,34,35)/t13-,17-,18-,19-/m0/s1 InChIKey=OJEKSZRBYRQNRU-VKOGCVSHSA-N |
| Database reference: |