BIOPEP-UWM: Report
| ID | 11179 |
| Name | Copper binding peptide |
| sequence |
| Function: | |||
| Copper binding | |||
| Number of residues | 8 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 831.8671 | Monoisotopic mass | 831.3750 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Camaño Echavarría J. A., Mathé C., Arnoux P., Stefan L., Paris C., Selmeczi K., Udenigwe C. C., Canabady-Rochelle L. | |
| Title | |
| Metal-chelating peptides derived from sunflower meal protein: preparation, isolation, identification, and antioxidant properties. ACS Food Sci. Technol., 5, 2336–2350, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)O InChI=1S/C37H53N9O13/c1-18(2)29(45-32(53)23(10-11-27(48)49)41-31(52)22(38)16-47)35(56)43-24(12-20-8-6-5-7-9-20)33(54)42-25(13-21-15-39-17-40-21)34(55)46-30(19(3)4)36(57)44-26(37(58)59)14-28(50)51/h5-9,15,17-19,22-26,29-30,47H,10-14,16,38H2,1-4H3,(H,39,40)(H,41,52)(H,42,54)(H,43,56)(H,44,57)(H,45,53)(H,46,55)(H,48,49)(H,50,51)(H,58,59)/t22-,23-,24-,25-,26-,29-,30-/m0/s1 InChIKey=HXBCVNGQJYVPOH-MBBAHBRISA-N |
| Database reference: |