BIOPEP-UWM: Report
| ID | 11181 |
| Name | Copper binding peptide |
| sequence |
| Function: | |||
| Copper binding | |||
| Number of residues | 7 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 853.9189 | Monoisotopic mass | 853.4070 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Camaño Echavarría J. A., Mathé C., Arnoux P., Stefan L., Paris C., Selmeczi K., Udenigwe C. C., Canabady-Rochelle L. | |
| Title | |
| Metal-chelating peptides derived from sunflower meal protein: preparation, isolation, identification, and antioxidant properties. ACS Food Sci. Technol., 5, 2336–2350, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CO)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CC(=O)N)C(=O)O InChI=1S/C39H55N11O11/c1-4-19(2)31(36(57)47-28(39(60)61)14-30(41)53)48-37(58)32(20(3)52)49-34(55)26(12-21-15-43-25-9-6-5-8-23(21)25)45-33(54)27(13-22-16-42-18-44-22)46-35(56)29-10-7-11-50(29)38(59)24(40)17-51/h5-6,8-9,15-16,18-20,24,26-29,31-32,43,51-52H,4,7,10-14,17,40H2,1-3H3,(H2,41,53)(H,42,44)(H,45,54)(H,46,56)(H,47,57)(H,48,58)(H,49,55)(H,60,61)/t19-,20+,24-,26-,27-,28-,29-,31-,32-/m0/s1 InChIKey=CQLBHBADVZPLJA-YRVPBQJTSA-N |
| Database reference: |