BIOPEP-UWM: Report
| ID | 11182 |
| Name | Copper binding peptide |
| sequence |
| Function: | |||
| Copper binding | |||
| Number of residues | 9 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 1041.0290 | Monoisotopic mass | 1040.4298 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Camaño Echavarría J. A., Mathé C., Arnoux P., Stefan L., Paris C., Selmeczi K., Udenigwe C. C., Canabady-Rochelle L. | |
| Title | |
| Metal-chelating peptides derived from sunflower meal protein: preparation, isolation, identification, and antioxidant properties. ACS Food Sci. Technol., 5, 2336–2350, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CC(=O)O)C(=O)NCC(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O InChI=1S/C44H60N14O16/c1-19(2)36(58-38(67)24(45)10-21-15-49-25-7-5-4-6-23(21)25)43(72)57-27(11-22-16-48-18-51-22)41(70)55-29(13-32(47)60)42(71)56-30(14-35(64)65)39(68)50-17-33(61)53-28(12-31(46)59)40(69)52-20(3)37(66)54-26(44(73)74)8-9-34(62)63/h4-7,15-16,18-20,24,26-30,36,49H,8-14,17,45H2,1-3H3,(H2,46,59)(H2,47,60)(H,48,51)(H,50,68)(H,52,69)(H,53,61)(H,54,66)(H,55,70)(H,56,71)(H,57,72)(H,58,67)(H,62,63)(H,64,65)(H,73,74)/t20-,24-,26-,27-,28-,29-,30-,36-/m0/s1 InChIKey=WLNJXRXUGPJMLN-RFINULSVSA-N |
| Database reference: |