BIOPEP-UWM: Report
ID | 11185 |
Name | Copper binding peptide |
sequence |
Function: | |||
Copper binding | |||
Number of residues | 6 |
Activity code | bin |
Activity : | binding |
|||
Chemical mass | 842.9425 | Monoisotopic mass | 842.4499 | |
EC50 : | 0.00 µM |
Bibliographic data: | |
Authors | |
Camaño Echavarría J. A., Mathé C., Arnoux P., Stefan L., Paris C., Selmeczi K., Udenigwe C. C., Canabady-Rochelle L. | |
Title | |
Metal-chelating peptides derived from sunflower meal protein: preparation, isolation, identification, and antioxidant properties. ACS Food Sci. Technol., 5, 2336–2350, 2025 | |
Year | Source |
2025 | Journal |
Additional information: |
BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)O)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C37H58N14O9/c1-3-20(2)29(51-33(57)26(15-21-9-5-4-6-10-21)49-30(54)23(38)17-28(52)53)34(58)47-24(11-7-13-44-36(39)40)31(55)50-27(16-22-18-43-19-46-22)32(56)48-25(35(59)60)12-8-14-45-37(41)42/h4-6,9-10,18-20,23-27,29H,3,7-8,11-17,38H2,1-2H3,(H,43,46)(H,47,58)(H,48,56)(H,49,54)(H,50,55)(H,51,57)(H,52,53)(H,59,60)(H4,39,40,44)(H4,41,42,45)/t20-,23-,24-,25-,26-,27-,29-/m0/s1 InChIKey=VEKGQDAIYFQKNC-AAYIBTABSA-N |
Database reference: |