BIOPEP-UWM: Report
| ID | 11186 |
| Name | Copper binding peptide |
| sequence |
| Function: | |||
| Copper binding | |||
| Number of residues | 6 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 683.7534 | Monoisotopic mass | 683.3381 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Camaño Echavarría J. A., Mathé C., Arnoux P., Stefan L., Paris C., Selmeczi K., Udenigwe C. C., Canabady-Rochelle L. | |
| Title | |
| Metal-chelating peptides derived from sunflower meal protein: preparation, isolation, identification, and antioxidant properties. ACS Food Sci. Technol., 5, 2336–2350, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C32H45N9O8/c1-16(2)9-25(32(48)49)40-29(45)23(10-19-13-35-22-8-6-5-7-21(19)22)39-30(46)24(11-20-14-34-15-36-20)38-28(44)17(3)37-31(47)27(18(4)42)41-26(43)12-33/h5-8,13-18,23-25,27,35,42H,9-12,33H2,1-4H3,(H,34,36)(H,37,47)(H,38,44)(H,39,46)(H,40,45)(H,41,43)(H,48,49)/t17-,18+,23-,24-,25-,27-/m0/s1 InChIKey=RLXQTPRVFDONAP-OJOMXQBRSA-N |
| Database reference: |