BIOPEP-UWM: Report
| ID | 11187 |
| Name | Copper binding peptide |
| sequence |
| Function: | |||
| Copper binding | |||
| Number of residues | 8 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 999.1244 | Monoisotopic mass | 998.5395 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Camaño Echavarría J. A., Mathé C., Arnoux P., Stefan L., Paris C., Selmeczi K., Udenigwe C. C., Canabady-Rochelle L. | |
| Title | |
| Metal-chelating peptides derived from sunflower meal protein: preparation, isolation, identification, and antioxidant properties. ACS Food Sci. Technol., 5, 2336–2350, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C44H70N16O11/c1-5-24(4)35(60-39(67)29(17-25-11-7-6-8-12-25)56-38(66)31(19-33(62)63)58-40(68)34(23(2)3)59-32(61)20-45)41(69)54-27(13-9-15-51-43(46)47)36(64)57-30(18-26-21-50-22-53-26)37(65)55-28(42(70)71)14-10-16-52-44(48)49/h6-8,11-12,21-24,27-31,34-35H,5,9-10,13-20,45H2,1-4H3,(H,50,53)(H,54,69)(H,55,65)(H,56,66)(H,57,64)(H,58,68)(H,59,61)(H,60,67)(H,62,63)(H,70,71)(H4,46,47,51)(H4,48,49,52)/t24-,27-,28-,29-,30-,31-,34-,35-/m0/s1 InChIKey=FZIPUBFWAJQYHW-CUMWVPHOSA-N |
| Database reference: |