BIOPEP-UWM: Report
| ID | 11188 |
| Name | Copper binding peptide |
| sequence |
| Function: | |||
| Copper binding | |||
| Number of residues | 8 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 885.9177 | Monoisotopic mass | 885.3968 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Camaño Echavarría J. A., Mathé C., Arnoux P., Stefan L., Paris C., Selmeczi K., Udenigwe C. C., Canabady-Rochelle L. | |
| Title | |
| Metal-chelating peptides derived from sunflower meal protein: preparation, isolation, identification, and antioxidant properties. ACS Food Sci. Technol., 5, 2336–2350, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)N)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CO)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(C(C)C)C(=O)O InChI=1S/C39H55N11O13/c1-19(2)31(39(62)63)49-35(58)24(12-21-8-5-4-6-9-21)46-34(57)26(15-30(53)54)45-32(55)20(3)44-33(56)25(13-22-16-42-18-43-22)47-36(59)27(17-51)48-37(60)28-10-7-11-50(28)38(61)23(40)14-29(41)52/h4-6,8-9,16,18-20,23-28,31,51H,7,10-15,17,40H2,1-3H3,(H2,41,52)(H,42,43)(H,44,56)(H,45,55)(H,46,57)(H,47,59)(H,48,60)(H,49,58)(H,53,54)(H,62,63)/t20-,23-,24-,25-,26-,27-,28-,31-/m0/s1 InChIKey=VJAFLDSQDHACRK-LJDKVGDASA-N |
| Database reference: |