BIOPEP-UWM: Report
| ID | 11200 |
| Name | PPARγ antagonist |
| sequence |
| Function: | |||
| Antagonist of Peroxisome proliferator-activated receptor γ (PPARγ) | |||
| Number of residues | 2 |
Activity code | ppar |
| Activity : | PPARγ antagonist |
|||
| Chemical mass | 319.3119 | Monoisotopic mass | 319.1164 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Deng G., Liu Z., Ye F., Luo X., Zhu W., Shen X., Liu H., Jiang H. | |
| Title | |
| Tryptophan-containing dipeptide derivatives as potent PPARγ antagonists: Design, synthesis, biological evaluation, and molecular modeling. Eur. J. Med. Chem., 43, 2699-2716, 2008 | |
| Year | Source |
| 2008 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(CC(=O)O)C(=O)O InChI=1S/C15H17N3O5/c16-10(14(21)18-12(15(22)23)6-13(19)20)5-8-7-17-11-4-2-1-3-9(8)11/h1-4,7,10,12,17H,5-6,16H2,(H,18,21)(H,19,20)(H,22,23)/t10-,12-/m0/s1 InChIKey=PEEAINPHPNDNGE-JQWIXIFHSA-N Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to the BIOPEP-UWM database of bioactive peptides; the EROP-Moscow database |
| Database reference: |
| BindingDB: ID BDBM50266632 BIOPEP-UWM database of bioactive peptides: ID 8930 BRENDA: Ligand L-Trp-L-Asp ChEBI: ID 74868 ChEMBL: ID CHEMBL476008 ChemSpider: ID 5382076 EROP-Moscow: ID E26074 FooDB: ID FDB112084 HMDB: ID HMDB0029079 J-GLOBAL: ID 200907093974044038 Metabolights: ID MTBLC74868 Metabolomics Workbench: ID 78999 Nikkaji: ID J1.371.359F PubChem: CID 7019108 SureChEMBL: ID SCHEMBL10434701 UniChem:ID 465872 Wikidata: ID Q27144977 ZINC: ID ZINC000002556664 |