BIOPEP-UWM: Report
| ID | 11201 |
| Name | PPARγ antagonist |
| sequence |
| Function: | |||
| Antagonist of Peroxisome proliferator-activated receptor γ (PPARγ) | |||
| Number of residues | 2 |
Activity code | ppar |
| Activity : | PPARγ antagonist |
|||
| Chemical mass | 319.3119 | Monoisotopic mass | 319.1164 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Deng G., Liu Z., Ye F., Luo X., Zhu W., Shen X., Liu H., Jiang H. | |
| Title | |
| Tryptophan-containing dipeptide derivatives as potent PPARγ antagonists: Design, synthesis, biological evaluation, and molecular modeling. Eur. J. Med. Chem., 43, 2699-2716, 2008 | |
| Year | Source |
| 2008 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@]([H])(CC(=O)O)C(=O)O InChI=1S/C15H17N3O5/c16-10(14(21)18-12(15(22)23)6-13(19)20)5-8-7-17-11-4-2-1-3-9(8)11/h1-4,7,10,12,17H,5-6,16H2,(H,18,21)(H,19,20)(H,22,23)/t10-,12+/m0/s1 InChIKey=PEEAINPHPNDNGE-CMPLNLGQSA-N |
| Database reference: |
| ChEBI: ID 74868 ChEMBL: ID CHEMBL476172 ChemSpider: ID 24697297 PubChem: CID 25185697 |