BIOPEP-UWM: Report
| ID | 11203 |
| Name | PPARγ antagonist |
| sequence |
| Function: | |||
| Antagonist of Peroxisome proliferator-activated receptor γ (PPARγ) | |||
| Number of residues | 2 |
Activity code | ppar |
| Activity : | PPARγ antagonist |
|||
| Chemical mass | 332.3536 | Monoisotopic mass | 332.1480 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Deng G., Liu Z., Ye F., Luo X., Zhu W., Shen X., Liu H., Jiang H. | |
| Title | |
| Tryptophan-containing dipeptide derivatives as potent PPARγ antagonists: Design, synthesis, biological evaluation, and molecular modeling. Eur. J. Med. Chem., 43, 2699-2716, 2008 | |
| Year | Source |
| 2008 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)O InChI=1S/C16H20N4O4/c17-11(7-9-8-19-12-4-2-1-3-10(9)12)15(22)20-13(16(23)24)5-6-14(18)21/h1-4,8,11,13,19H,5-7,17H2,(H2,18,21)(H,20,22)(H,23,24)/t11-,13-/m0/s1 InChIKey=NZCPCJCJZHKFGZ-AAEUAGOBSA-N Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to the BIOPEP-UWM database of bioactive peptides (ID 8678); the EROP-Moscow database |
| Database reference: |
| AHTPDB: ID 1337, 4151, 4948 BindingDB: ID BDBM50266654 BIOPEP-UWM database of bioactive peptides: ID 8678 ChEBI: ID 157897 ChEMBL: ID CHEMBL476173 ChemSpider: ID 24697298 DSigDB: ID d4ttd_6061 EROP-Moscow: ID E10609 Metabolomics Workbench: ID 79001 PubChem: CID 25185698 SATPdb: ID satpdb18242 SureChEMBL: ID SCHEMBL5970454 ZINC: ID ZINC000040439750 |