BIOPEP-UWM: Report
| ID | 11204 |
| Name | PPARγ antagonist |
| sequence |
| Function: | |||
| Antagonist of Peroxisome proliferator-activated receptor γ (PPARγ) | |||
| Number of residues | 2 |
Activity code | ppar |
| Activity : | PPARγ antagonist |
|||
| Chemical mass | 347.3649 | Monoisotopic mass | 347.1476 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Deng G., Liu Z., Ye F., Luo X., Zhu W., Shen X., Liu H., Jiang H. | |
| Title | |
| Tryptophan-containing dipeptide derivatives as potent PPARγ antagonists: Design, synthesis, biological evaluation, and molecular modeling. Eur. J. Med. Chem., 43, 2699-2716, 2008 | |
| Year | Source |
| 2008 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@H](CCCC(=O)O)C(=O)O InChI=1S/C17H21N3O5/c18-12(8-10-9-19-13-5-2-1-4-11(10)13)16(23)20-14(17(24)25)6-3-7-15(21)22/h1-2,4-5,9,12,14,19H,3,6-8,18H2,(H,20,23)(H,21,22)(H,24,25)/t12-,14-/m0/s1 InChIKey=LKKDYAZRMNSFJN-JSGCOSHPSA-N <Aad> - L-2-Aminoadipic acid (ID 246 in the BIOPEP-UWM repository of amino acids and modifications) |
| Database reference: |
| BindingDB: ID 50266633 ChEMBL: ID CHEMBL515773 ChemSpider: ID 24716573 DSigDB: ID d4ttd_6335 PubChem: CID 25185696 ZINC: ID ZINC000040406729 |