BIOPEP-UWM: Report
| ID | 11205 |
| Name | PPARγ antagonist |
| sequence |
| Function: | |||
| Antagonist of Peroxisome proliferator-activated receptor γ (PPARγ) | |||
| Number of residues | 2 |
Activity code | ppar |
| Activity : | PPARγ antagonist |
|||
| Chemical mass | 317.3819 | Monoisotopic mass | 317.1734 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Deng G., Liu Z., Ye F., Luo X., Zhu W., Shen X., Liu H., Jiang H. | |
| Title | |
| Tryptophan-containing dipeptide derivatives as potent PPARγ antagonists: Design, synthesis, biological evaluation, and molecular modeling. Eur. J. Med. Chem., 43, 2699-2716, 2008 | |
| Year | Source |
| 2008 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C17H23N3O3/c1-10(2)7-15(17(22)23)20-16(21)13(18)8-11-9-19-14-6-4-3-5-12(11)14/h3-6,9-10,13,15,19H,7-8,18H2,1-2H3,(H,20,21)(H,22,23)/t13-,15-/m0/s1 InChIKey=LYMVXFSTACVOLP-ZFWWWQNUSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database; the BIOPEP-UWM database of bioactive peptides (ID 9107) Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to the BIOPEP-UWM database of bioactive peptides (ID 8677) Bitter peptide according to the BIOPEP-UWM database of sensory peptides and amino acids; the BitterDB database |
| Database reference: |
| AHTPDB: ID 1463; 1900; 2968; 4724; 5181; 6216; 6220; 6862 BindingDB: ID 50266681 BIOPEP-UWM database of bioactive peptides: ID 8677; 9107 BIOPEP-UWM database of sensory peptides and amino acids: ID 338 BRENDA: Ligand Trp-Leu BitterDB: ID 830 ChEBI: ID 74871 ChEMBL: ID CHEMBL477627 ChemSpider: ID 5365198 eMolecules: ID 8294262 EROP-Moscow: ID E06385 FooDB: ID FDB098230 HMDB: ID HMDB0029087 J-GLOBAL: ID 200907089186452560 Metabolights: ID MTBLC74871 Metabolomics Workbench: ID 79006 Nikkaji: ID J236.159K PLantPepDB: ID PPepDB_3839 PubChem: ID 6997509 Sabio-RK: ID 24732 SATPdb: ID satpdb20928 SureChEMBL: ID SCHEMBL7622341 Therapeutic Target Database (TTD): ID DNC009657 UniChem: ID 299509 Wikidata: ID Q27144982 ZINC: ID ZINC000001865984 |