BIOPEP-UWM: Report
| ID | 11206 |
| Name | PPARγ antagonist |
| sequence |
| Function: | |||
| Antagonist of Peroxisome proliferator-activated receptor γ (PPARγ) | |||
| Number of residues | 2 |
Activity code | ppar |
| Activity : | PPARγ antagonist |
|||
| Chemical mass | 318.3271 | Monoisotopic mass | 318.1324 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Deng G., Liu Z., Ye F., Luo X., Zhu W., Shen X., Liu H., Jiang H. | |
| Title | |
| Tryptophan-containing dipeptide derivatives as potent PPARγ antagonists: Design, synthesis, biological evaluation, and molecular modeling. Eur. J. Med. Chem., 43, 2699-2716, 2008 | |
| Year | Source |
| 2008 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(CC(=O)N)C(=O)O InChI=1S/C15H18N4O4/c16-10(14(21)19-12(15(22)23)6-13(17)20)5-8-7-18-11-4-2-1-3-9(8)11/h1-4,7,10,12,18H,5-6,16H2,(H2,17,20)(H,19,21)(H,22,23)/t10-,12-/m0/s1 InChIKey=GRQCSEWEPIHLBI-JQWIXIFHSA-N Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to the BIOPEP-UWM database of bioactive peptides (ID 8680); the EROP-Moscow database |
| Database reference: |
| BindingDB: ID 50266679 BIOPEP-UWM database of bioactive peptides: ID 8680 BRENDA: Ligand L-tryptophyl-L-asparagine CAS: Registry No 175027-11-9 ChEBI: ID 141447 ChEMBL: ID CHEMBL513911 ChemSpider: ID 5383126 DSigDB: ID d4ttd_6326 EPA CompTox: ID DTXSID901334463 EROP-Moscow: ID E10610 PubChem: CID 7020170 SureChEMBL: ID SCHEMBL21641799 UniChem: ID 256704 Wikidata: ID Q106026419 ZINC: ID ZINC000002561118 |