BIOPEP-UWM: Report
| ID | 11207 |
| Name | PPARγ antagonist |
| sequence |
| Function: | |||
| Antagonist of Peroxisome proliferator-activated receptor γ (PPARγ) | |||
| Number of residues | 2 |
Activity code | ppar |
| Activity : | PPARγ antagonist |
|||
| Chemical mass | 360.4099 | Monoisotopic mass | 360.1905 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Deng G., Liu Z., Ye F., Luo X., Zhu W., Shen X., Liu H., Jiang H. | |
| Title | |
| Tryptophan-containing dipeptide derivatives as potent PPARγ antagonists: Design, synthesis, biological evaluation, and molecular modeling. Eur. J. Med. Chem., 43, 2699-2716, 2008 | |
| Year | Source |
| 2008 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C17H24N6O3/c18-12(8-10-9-22-13-5-2-1-4-11(10)13)15(24)23-14(16(25)26)6-3-7-21-17(19)20/h1-2,4-5,9,12,14,22H,3,6-8,18H2,(H,23,24)(H,25,26)(H4,19,20,21)/t12-,14-/m0/s1 InChIKey=LCPVBXOHXMBLFW-JSGCOSHPSA-N Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to the BIOPEP-UWM database of bioactive peptides (ID 8675); the EROP-Mocow database |
| Database reference: |
| BindingDB: ID 50266680 BIOPEP-UWM database of bioactive peptides (ID 8675) BMDB: ID BMDB62263 BRENDA: Ligand L-tryptophyl-L-arginine ChEBI: ID 74866 ChEMBL: ID CHEMBL477417 EROP-Moscow: ID E10607 FooDB: ID FDB098229 HMDB: ID HMDB0029077 J-GLOBAL: ID 200907094178310172 Metabolights: ID MTBLC74866 Metabolomics Workbench: ID 78997 Nikkaji: ID J1.237.420H PubChem: CID 25186251 SureChEMBL: ID SCHEMBL4947728 UniChem: ID 75466 Wikidata: ID Q27144975 ZINC: ID ZINC000002561117 |