BIOPEP-UWM: Report
| ID | 11214 |
| Name | Pseudolysin inhibitor |
| sequence |
| Function: | |||
| Inhibitor of pseudolysin (EC 3.4.24.26; MEROPS ID: M04.005) | |||
| Number of residues | 3 |
Activity code | pseud |
| Activity : | pseudolysin inhibitor |
|||
| Chemical mass | 358.3258 | Monoisotopic mass | 358.1288 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kessler E., Israel M., Landshman N., Chechick A., Blumberg S. | |
| Title | |
| In vitro inhibition of Pseudomonas aeruginosa elastase by metal-chelating peptide derivatives. Infect. Immun., 38, 716-723, 1982 | |
| Year | Source |
| 1982 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: OP(=O)(O)N[C@@]([H])(CC(C)C)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C15H23N2O6P/c1-10(2)8-12(17-24(21,22)23)14(18)16-13(15(19)20)9-11-6-4-3-5-7-11/h3-7,10,12-13H,8-9H2,1-2H3,(H,16,18)(H,19,20)(H3,17,21,22,23)/t12-,13-/m0/s1 InChIKey=XHDKBRXIGMXIDI-STQMWFEESA-N {H3PO4} - Phosphoric acid (ID 248 in the BIOPEP-UWM repository of amino acids and modifications) Inhibitor of thermolysin (EC 3.4.24.27) (MEROPS ID: M04.001) according to the BIOPEP-UWM database of bioactive peptides; the BRENDA database |
| Database reference: |
| BRENDA: Ligand N-Phosphoryl-Leu-Phe-OH CAS: Registry No 80826-98-8 ChemSpider: ID 117803 EPA CompTox: ID DTXCID501428492 J-Global: ID 200907076114040386 MeSH: terms phosphorylleucylphenylalanine; L-phenylalanine, N-(N-phosphono-L-leucyl)-; phospho-Leu-Phe; phosphoryl-Leu-Phe; phosphoryl-leucyl-phenylalanine Nikkaji: ID J487.045J PubChem: CID 133544 SureChEMBL: ID SCHEMBL29545788 UniChem: ID 42153719 Wikidata: ID Q82995488 |