BIOPEP-UWM: Report
| ID | 11218 |
| Name | Thermolysin inhibitor |
| sequence |
| Function: | |||
| Inhibitor of thermolysin (EC 3.4.24.27) (MEROPS ID: M04.001) | |||
| Number of residues | 3 |
Activity code | therm |
| Activity : | thermolysin inhibitor |
|||
| Chemical mass | 397.3618 | Monoisotopic mass | 397.1397 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kam C. M., Nishino N., Powers J. C. | |
| Title | |
| Inhibition of thermolysin and carboxypeptidase A by phosphoramidates. Biochemistry, 18, 3032-3038, 1979 | |
| Year | Source |
| 1979 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: OP(=O)(O)N[C@@]([H])(CC(C)C)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)O InChI=1S/C17H24N3O6P/c1-10(2)7-14(20-27(24,25)26)16(21)19-15(17(22)23)8-11-9-18-13-6-4-3-5-12(11)13/h3-6,9-10,14-15,18H,7-8H2,1-2H3,(H,19,21)(H,22,23)(H3,20,24,25,26)/t14-,15-/m0/s1 InChIKey=GKNMEOYLZHYYGW-GJZGRUSLSA-N {H3PO4} - Phosphoric acid (ID 248 in the BIOPEP-UWM repository of amino acids and modifications) Inhibitor of Endothelin-converting enzyme 1 (EC 3.4.24.71) (MEROPS ID: M13.002) according to the ChEMBL database |
| Database reference: |
| BindingDB: ID 50287436 BRENDA: Ligand N-Phosphoryl-Leu-Trp-OH CAS: Registry No 56361-75-2 ChEMBL: ID CHEMBL291174 ChemSpider: ID 7976697 EPA CompTox: ID DTXSID10204916 FDA SRS: ID DM5WA46L8D J-GLOBAL: ID 200907076832773073 Nikkaji: ID J487.044A PubChem: CID 9800935 SureChEMBL: ID SCHEMBL14503216 UniChem: ID 587398 UNII: ID DM5WA46L8D Wikidata: ID Q83078397 ZINC: ID ZINC000013515640 |