BIOPEP-UWM: Report
| ID | 11219 |
| Name | Thermolysin inhibitor |
| sequence |
| Function: | |||
| Inhibitor of thermolysin (EC 3.4.24.27) (MEROPS ID: M04.001) | |||
| Number of residues | 3 |
Activity code | therm |
| Activity : | thermolysin inhibitor |
|||
| Chemical mass | 282.2300 | Monoisotopic mass | 282.0976 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kam C. M., Nishino N., Powers J. C. | |
| Title | |
| Inhibition of thermolysin and carboxypeptidase A by phosphoramidates. Biochemistry, 18, 3032-3038, 1979 | |
| Year | Source |
| 1979 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: OP(=O)(O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(C)C(=O)O InChI=1S/C9H19N2O6P/c1-4-5(2)7(11-18(15,16)17)8(12)10-6(3)9(13)14/h5-7H,4H2,1-3H3,(H,10,12)(H,13,14)(H3,11,15,16,17)/t5-,6-,7-/m0/s1 InChIKey=BIOSNRSPRYKFCL-ACZMJKKPSA-N {H3PO4} - Phosphoric acid (ID 248 in the BIOPEP-UWM repository of amino acids and modifications) |
| Database reference: |
| BindingDB: ID 50474132 ChEMBL: ID CHEMBL2372512 ChemSpider: ID 30809745 PubChem: CID 71355522 |