BIOPEP-UWM: Report
| ID | 11224 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 5 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 618.7871 | Monoisotopic mass | 618.3189 | |
| IC50 : | 261.32 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang Z., Shu G., Nan J., Meng F., Zhang M., Chen L. | |
| Title | |
| Exploring the healthy potential of goat milk fermented by novel isolated lactic acid bacteria: Genetic identification, bioactive peptides, nutritional mechanism and sensory evaluation. Int. J. Food Microbiol., 442, 111354, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCSC)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C30H46N6O6S/c1-43-18-14-21(32)28(39)35-16-7-12-24(35)27(38)34-23(19-20-9-3-2-4-10-20)29(40)36-17-8-13-25(36)26(37)33-22(30(41)42)11-5-6-15-31/h2-4,9-10,21-25H,5-8,11-19,31-32H2,1H3,(H,33,37)(H,34,38)(H,41,42)/t21-,22-,23-,24-,25-/m0/s1 InChIKey=GTKKMTCBTXICMV-KEOOTSPTSA-N |
| Database reference: |