BIOPEP-UWM: Report
| ID | 11239 |
| Name | Antifungal peptide |
| sequence |
| Function: | |||
| Antifungal | |||
| Number of residues | 3 |
Activity code | af |
| Activity : | antifungal |
|||
| Chemical mass | 545.6346 | Monoisotopic mass | 545.2856 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Rai N., Tiwari R. T., Sahu A., Verma E., Rathore S., Patil S., Patil A. G. | |
| Title | |
| Exploring tryptophan-based short peptides: promising candidate for anticancer and antimicrobial therapies. Anti-Cancer Agents Med. Chem., 25, 124-133, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N InChI=1S/C28H35N9O3/c29-20(8-5-11-33-28(31)32)26(39)37-24(13-17-15-35-22-10-4-2-7-19(17)22)27(40)36-23(25(30)38)12-16-14-34-21-9-3-1-6-18(16)21/h1-4,6-7,9-10,14-15,20,23-24,34-35H,5,8,11-13,29H2,(H2,30,38)(H,36,40)(H,37,39)(H4,31,32,33)/t20-,23-,24-/m0/s1 InChIKey=VDVAZZCSPXRKAH-OYDLWJJNSA-N |
| Database reference: |