BIOPEP-UWM: Report
| ID | 11243 |
| Name | Antifungal peptide |
| sequence |
| Function: | |||
| Antifungal | |||
| Number of residues | 4 |
Activity code | af |
| Activity : | antifungal |
|||
| Chemical mass | 663.7274 | Monoisotopic mass | 663.3023 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Rai N., Tiwari R. T., Sahu A., Verma E., Rathore S., Patil S., Patil A. G. | |
| Title | |
| Exploring tryptophan-based short peptides: promising candidate for anticancer and antimicrobial therapies. Anti-Cancer Agents Med. Chem., 25, 124-133, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N InChI=1S/C34H37N11O4/c35-25(11-21-15-37-17-41-21)32(47)44-30(12-22-16-38-18-42-22)34(49)45-29(10-20-14-40-27-8-4-2-6-24(20)27)33(48)43-28(31(36)46)9-19-13-39-26-7-3-1-5-23(19)26/h1-8,13-18,25,28-30,39-40H,9-12,35H2,(H2,36,46)(H,37,41)(H,38,42)(H,43,48)(H,44,47)(H,45,49)/t25-,28-,29-,30-/m0/s1 InChIKey=FEAWXUMQVQDFSC-ABYARXGNSA-N |
| Database reference: |