BIOPEP-UWM: Report
| ID | 11258 |
| Name | Anticancer peptide |
| sequence |
| Function: | |||
| Anticancer | |||
| Number of residues | 4 |
Activity code | ac |
| Activity : | anticancer |
|||
| Chemical mass | 531.6048 | Monoisotopic mass | 531.2587 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Rai N., Tiwari R. T., Sahu A., Verma E., Rathore S., Patil S., Patil A. G. | |
| Title | |
| Exploring tryptophan-based short peptides: promising candidate for anticancer and antimicrobial therapies. Anti-Cancer Agents Med. Chem., 25, 124-133, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C)C(=O)N[C@@]([H])(C)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N InChI=1S/C40H41N7O4/c41-31(19-25-11-3-1-4-12-25)38(49)46-35(20-26-13-5-2-6-14-26)39(50)47-36(22-28-24-44-33-18-10-8-16-30(28)33)40(51)45-34(37(42)48)21-27-23-43-32-17-9-7-15-29(27)32/h1-18,23-24,31,34-36,43-44H,19-22,41H2,(H2,42,48)(H,45,51)(H,46,49)(H,47,50)/t31-,34-,35-,36-/m0/s1 InChIKey=PCOFLNZLULUBJL-SNZVYYTPSA-N |
| Database reference: |