BIOPEP-UWM: Report
| ID | 11262 |
| Name | Cytotoxic peptide |
| sequence |
| Function: | |||
| Cytotoxic | |||
| Number of residues | 4 |
Activity code | tox |
| Activity : | toxic |
|||
| Chemical mass | 683.7964 | Monoisotopic mass | 683.3211 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Rai N., Tiwari R. T., Sahu A., Verma E., Rathore S., Patil S., Patil A. G. | |
| Title | |
| Exploring tryptophan-based short peptides: promising candidate for anticancer and antimicrobial therapies. Anti-Cancer Agents Med. Chem., 25, 124-133, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N InChI=1S/C34H47N9O4/c35-15-7-5-11-25(37)32(45)41-28(14-6-8-16-36)33(46)43-30(18-22-20-40-27-13-4-2-10-24(22)27)34(47)42-29(31(38)44)17-21-19-39-26-12-3-1-9-23(21)26/h1-4,9-10,12-13,19-20,25,28-30,39-40H,5-8,11,14-18,35-37H2,(H2,38,44)(H,41,45)(H,42,47)(H,43,46)/t25-,28-,29-,30-/m0/s1 InChIKey=RSVFSNDXSYKOQV-ABYARXGNSA-N |
| Database reference: |