BIOPEP-UWM: Report
| ID | 11263 |
| Name | Inhibitor of peptidylprolyl isomerase |
| sequence |
| Function: | |||
| Inhibitor of peptidylprolyl isomerase (EC 5.2.1.8) | |||
| Number of residues | 5 |
Activity code | ppi |
| Activity : | peptidylprolyl isomerase inhibitor |
|||
| Chemical mass | 495.5265 | Monoisotopic mass | 495.2111 | |
| IC50 : | 770.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Demange L., Moutiez M., Vaudry K., Dugave C. | |
| Title | |
| Interaction of human cyclophilin hCyp-18 with short peptides suggests the existence of two functionally independent subsites. FEBS Lett., 505, 191-195, 2001 | |
| Year | Source |
| 2001 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: CC(=O)N[C@@]([H])(C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)NC1=CC=C([N+](=O)[O-])C=C1 InChI=1S/C25H29N5O6/c1-16(26-17(2)31)25(34)29-14-6-9-22(29)24(33)28-21(15-18-7-4-3-5-8-18)23(32)27-19-10-12-20(13-11-19)30(35)36/h3-5,7-8,10-13,16,21-22H,6,9,14-15H2,1-2H3,(H,26,31)(H,27,32)(H,28,33)/t16-,21-,22-/m0/s1 InChIKey=WZYNCOIWGSLTHX-SSKFGXFMSA-N {C2:0} - Acetic acid - N-terminal modification (ID 130 in the BIOPEP-UWM repository of amino acids and modifications) {~!ph[4NO2]} - 4-Nitroaniline - C-terminal modification (ID 259 in the BIOPEP-UWM repository of amino acids and modifications) |
| Database reference: |
| BRENDA: Ligand acetyl-Ala-Pro-Phe-4-nitroanilide |