BIOPEP-UWM: Report
| ID | 11264 |
| Name | Inhibitor of peptidylprolyl isomerase |
| sequence |
| Function: | |||
| Inhibitor of peptidylprolyl isomerase (EC 5.2.1.8) | |||
| Number of residues | 5 |
Activity code | ppi |
| Activity : | peptidylprolyl isomerase inhibitor |
|||
| Chemical mass | 508.6309 | Monoisotopic mass | 508.2915 | |
| IC50 : | 7000.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Demange L., Moutiez M., Vaudry K., Dugave C. | |
| Title | |
| Interaction of human cyclophilin hCyp-18 with short peptides suggests the existence of two functionally independent subsites. FEBS Lett., 505, 191-195, 2001 | |
| Year | Source |
| 2001 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: CC(=O)N[C@@]([H])(C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)NC1=CC=C([N+](C)(C)(C))C=C1 InChI=1S/C28H37N5O4/c1-19(29-20(2)34)28(37)32-17-9-12-25(32)27(36)31-24(18-21-10-7-6-8-11-21)26(35)30-22-13-15-23(16-14-22)33(3,4)5/h6-8,10-11,13-16,19,24-25H,9,12,17-18H2,1-5H3,(H2-,29,30,31,34,35,36)/p+1/t19-,24-,25-/m0/s1 InChIKey=FACOXEPPUHGTQT-LQGLAIQGSA-O <C2:0> - Acetic acid - N-terminal modification (ID 130 in the BIOPEP-UWM repository of amino acids and modifications) <~!ph[4N(CH3)3]> - 4-Amino-N,N,N-trimethylanilinium - C-terminal modification (ID 258 in the BIOPEP-UWM repository of amino acids and modifications) |
| Database reference: |
| BRENDA: Ligand acetyl-Ala-Pro-Phe-4-(trimethylammonium)anilide |