BIOPEP-UWM: Report
| ID | 11265 |
| Name | Inhibitor of peptidylprolyl isomerase |
| sequence |
| Function: | |||
| Inhibitor of peptidylprolyl isomerase (EC 5.2.1.8) | |||
| Number of residues | 4 |
Activity code | ppi |
| Activity : | peptidylprolyl isomerase inhibitor |
|||
| Chemical mass | 356.3733 | Monoisotopic mass | 356.1690 | |
| IC50 : | 14000.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Demange L., Moutiez M., Vaudry K., Dugave C. | |
| Title | |
| Interaction of human cyclophilin hCyp-18 with short peptides suggests the existence of two functionally independent subsites. FEBS Lett., 505, 191-195, 2001 | |
| Year | Source |
| 2001 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: OC(=O)CCC(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C)C(=O)N1[C@@]([H])(CCC1)C(=O)N InChI=1S/C15H24N4O6/c1-8(17-11(20)5-6-12(21)22)14(24)18-9(2)15(25)19-7-3-4-10(19)13(16)23/h8-10H,3-7H2,1-2H3,(H2,16,23)(H,17,20)(H,18,24)(H,21,22)/t8-,9-,10-/m0/s1 InChIKey=NMVJYKRWPMUPJD-GUBZILKMSA-N {C3:0[3COOH]} - Succinic acid - N-terminal modification (ID 257 in the BIOPEP-UWM repository of amino acids and modifications) |
| Database reference: |
| BRENDA: Ligand succinyl-Ala-Ala-Pro-NH2 |