BIOPEP-UWM: Report
| ID | 11266 |
| Name | Inhibitor of peptidylprolyl isomerase |
| sequence |
| Function: | |||
| Inhibitor of peptidylprolyl isomerase (EC 5.2.1.8) | |||
| Number of residues | 6 |
Activity code | ppi |
| Activity : | peptidylprolyl isomerase inhibitor |
|||
| Chemical mass | 637.6786 | Monoisotopic mass | 637.2738 | |
| IC50 : | 4400.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Demange L., Moutiez M., Vaudry K., Dugave C. | |
| Title | |
| Interaction of human cyclophilin hCyp-18 with short peptides suggests the existence of two functionally independent subsites. FEBS Lett., 505, 191-195, 2001 | |
| Year | Source |
| 2001 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: OC(=O)CCC(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)NC1=CC=C(C=C1)CC(=O)O InChI=1S/C32H39N5O9/c1-19(33-26(38)14-15-27(39)40)29(43)34-20(2)32(46)37-16-6-9-25(37)31(45)36-24(17-21-7-4-3-5-8-21)30(44)35-23-12-10-22(11-13-23)18-28(41)42/h3-5,7-8,10-13,19-20,24-25H,6,9,14-18H2,1-2H3,(H,33,38)(H,34,43)(H,35,44)(H,36,45)(H,39,40)(H,41,42)/t19-,20-,24-,25-/m0/s1 InChIKey=HWYXFDQUUOJHDU-WNLYKICVSA-N {C3:0[3COOH]} - Succinic acid - N-terminal modification (ID 257 in the BIOPEP-UWM repository of amino acids and modifications) {C2:0[2ph;6NH2]} - 4-Aminophenylacetic acid (ID 260 in the BIOPEP-UWM repository of amino acids and modifications) |
| Database reference: |
| BRENDA: Ligand succinyl-Ala-Ala-Pro-Phe-4-carboxymethylanilide |