BIOPEP-UWM: Report
| ID | 11267 |
| Name | Inhibitor of peptidylprolyl isomerase |
| sequence |
| Function: | |||
| Inhibitor of peptidylprolyl isomerase (EC 5.2.1.8) | |||
| Number of residues | 5 |
Activity code | ppi |
| Activity : | peptidylprolyl isomerase inhibitor |
|||
| Chemical mass | 477.4667 | Monoisotopic mass | 477.1853 | |
| IC50 : | 540.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Demange L., Moutiez M., Vaudry K., Dugave C. | |
| Title | |
| Interaction of human cyclophilin hCyp-18 with short peptides suggests the existence of two functionally independent subsites. FEBS Lett., 505, 191-195, 2001 | |
| Year | Source |
| 2001 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: OC(=O)CCC(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C)C(=O)N1[C@@]([H])(CCC1)C(=O)NC1=CC=C([N+](=O)[O-])C=C1 InChI=1S/C21H27N5O8/c1-12(22-17(27)9-10-18(28)29)19(30)23-13(2)21(32)25-11-3-4-16(25)20(31)24-14-5-7-15(8-6-14)26(33)34/h5-8,12-13,16H,3-4,9-11H2,1-2H3,(H,22,27)(H,23,30)(H,24,31)(H,28,29)/t12-,13-,16-/m0/s1 InChIKey=XTZBWJQWDZTXFI-XEZPLFJOSA-N {C3:0[3COOH]} - Succinic acid - N-terminal modification (ID 257 in the BIOPEP-UWM repository of amino acids and modifications) {~!ph[4NO2]} - 4-Nitroaniline - C-terminal modification (ID 259 in the BIOPEP-UWM repository of amino acids and modifications) |
| Database reference: |
| BRENDA: Ligand succinyl-Ala-Ala-Pro-Phe-4-nitroanilide |