BIOPEP-UWM: Report
| ID | 11269 |
| Name | Inhibitor of peptidylprolyl isomerase |
| sequence |
| Function: | |||
| Inhibitor of peptidylprolyl isomerase (EC 5.2.1.8) | |||
| Number of residues | 5 |
Activity code | ppi |
| Activity : | peptidylprolyl isomerase inhibitor |
|||
| Chemical mass | 523.5795 | Monoisotopic mass | 523.2423 | |
| IC50 : | 5800.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Demange L., Moutiez M., Vaudry K., Dugave C. | |
| Title | |
| Interaction of human cyclophilin hCyp-18 with short peptides suggests the existence of two functionally independent subsites. FEBS Lett., 505, 191-195, 2001 | |
| Year | Source |
| 2001 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: OC(=O)CCC(=O)N[C@@]([H])(C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)NC1=CC=C(C=C1)N InChI=1S/C27H33N5O6/c1-17(29-23(33)13-14-24(34)35)27(38)32-15-5-8-22(32)26(37)31-21(16-18-6-3-2-4-7-18)25(36)30-20-11-9-19(28)10-12-20/h2-4,6-7,9-12,17,21-22H,5,8,13-16,28H2,1H3,(H,29,33)(H,30,36)(H,31,37)(H,34,35)/t17-,21-,22-/m0/s1 InChIKey=BEKVBCIXYBXBRM-HSQYWUDLSA-N {C3:0[3COOH]} - Succinic acid - N-terminal modification (ID 257 in the BIOPEP-UWM repository of amino acids and modifications) {~!ph[4NH2]} - p-Phenylenediamine - C-terminal modification (ID 261 in the BIOPEP-UWM repository of amino acids and modifications) |
| Database reference: |
| BRENDA: Ligand succinyl-Ala-Pro-Phe-4-aminoanilide |