BIOPEP-UWM: Report
| ID | 11274 |
| Name | Inhibitor of peptidylprolyl isomerase |
| sequence |
| Function: | |||
| Inhibitor of peptidylprolyl isomerase (EC 5.2.1.8) | |||
| Number of residues | 7 |
Activity code | ppi |
| Activity : | peptidylprolyl isomerase inhibitor |
|||
| Chemical mass | 619.6650 | Monoisotopic mass | 619.2956 | |
| IC50 : | 85.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang Y., Fuessel S., Reimer U., Schutkowski M., Fischer G. | |
| Title | |
| Substrate-based design of reversible Pin1 inhibitors. Biochemistry, 41, 11868-11877, 2002 | |
| Year | Source |
| 2002 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: CC(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C)C(=O)N[C@]([H])(CO)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)NC1=CC=C([N+](=O)[O-])C=C1 InChI=1S/C28H41N7O9/c1-15(2)13-21(26(40)31-19-8-10-20(11-9-19)35(43)44)32-27(41)23-7-6-12-34(23)28(42)22(14-36)33-25(39)17(4)30-24(38)16(3)29-18(5)37/h8-11,15-17,21-23,36H,6-7,12-14H2,1-5H3,(H,29,37)(H,30,38)(H,31,40)(H,32,41)(H,33,39)/t16-,17-,21-,22+,23-/m0/s1 InChIKey=JLONSKCAQGKBCM-WFDRNDOFSA-N {C2:0} - Acetic acid - N-terminal modification (ID 130 in the BIOPEP-UWM repository of amino acids and modifications) {~!ph[4NO2]} - 4-Nitroaniline - C-terminal modification (ID 259 in the BIOPEP-UWM repository of amino acids and modifications) |
| Database reference: |
| BRENDA: Ligand acetyl-Ala-Ala-D-Ser-Pro-Leu-NH-4-nitroanilide |