BIOPEP-UWM: Report
| ID | 11275 |
| Name | Inhibitor of peptidylprolyl isomerase |
| sequence |
| Function: | |||
| Inhibitor of peptidylprolyl isomerase (EC 5.2.1.8) | |||
| Number of residues | 2 |
Activity code | ppi |
| Activity : | peptidylprolyl isomerase inhibitor |
|||
| Chemical mass | 282.1871 | Monoisotopic mass | 282.0613 | |
| IC50 : | 1000.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang Y., Fuessel S., Reimer U., Schutkowski M., Fischer G. | |
| Title | |
| Substrate-based design of reversible Pin1 inhibitors. Biochemistry, 41, 11868-11877, 2002 | |
| Year | Source |
| 2002 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@H](COP(=O)(O)O)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C8H15N2O7P/c9-5(4-17-18(14,15)16)7(11)10-3-1-2-6(10)8(12)13/h5-6H,1-4,9H2,(H,12,13)(H2,14,15,16)/t5-,6+/m1/s1 InChIKey=BUFZSKJMMURVEP-RITPCOANSA-N {s[3*]} - Phospho-D-serine (ID 262 in the BIOPEP-UWM repository of amino acids and modifications) |
| Database reference: |
| BRENDA: Ligand D-Ser(PO3H2)-Pro |