BIOPEP-UWM: Report
| ID | 11277 |
| Name | Inhibitor of peptidylprolyl isomerase |
| sequence |
| Function: | |||
| Inhibitor of peptidylprolyl isomerase (EC 5.2.1.8) | |||
| Number of residues | 5 |
Activity code | ppi |
| Activity : | peptidylprolyl isomerase inhibitor |
|||
| Chemical mass | 632.7295 | Monoisotopic mass | 632.2409 | |
| IC50 : | 97.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang Y., Fuessel S., Reimer U., Schutkowski M., Fischer G. | |
| Title | |
| Substrate-based design of reversible Pin1 inhibitors. Biochemistry, 41, 11868-11877, 2002 | |
| Year | Source |
| 2002 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CO)C(=S)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)NC1=CC=C([N+](=O)[O-])C=C1 InChI=1S/C32H36N6O6S/c33-25(18-21-8-3-1-4-9-21)29(40)36-27(20-39)32(45)37-17-7-12-28(37)31(42)35-26(19-22-10-5-2-6-11-22)30(41)34-23-13-15-24(16-14-23)38(43)44/h1-6,8-11,13-16,25-28,39H,7,12,17-20,33H2,(H,34,41)(H,35,42)(H,36,40)/t25-,26-,27-,28-/m0/s1 InChIKey=YLVFWGXUDUNQQV-LJWNLINESA-N {!C3:0[1S;1OH;2(S)NH2;3OH]} - L-Seryl-[pcp] tautomer (ID 263 in the BIOPEP-UWM repository of amino acids and modifications) {~!ph[4NO2]} - 4-Nitroaniline - C-terminal modification (ID 259 in the BIOPEP-UWM repository of amino acids and modifications) |
| Database reference: |
| BRENDA: Ligand Phe-Ser-PSI[CS-N]-Pro-Phe-NH-4-nitroanilide |