BIOPEP-UWM: Report
| ID | 11281 |
| Name | Microbial collagenase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Microbial collagenase (EC 3.4.24.3; MEROPS ID: M09.002) | |||
| Number of residues | 11 |
Activity code | mci |
| Activity : | microbial collagenase inhibitor |
|||
| Chemical mass | 942.0926 | Monoisotopic mass | 941.4738 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang R., Li Y., Li Y., Zhang H. | |
| Title | |
| Discovering potential anti‑skin‑aging peptides in collagen: computer‑assisted rapid screening and structure–activity relationships. Collagen and Leather, 7, 30, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(O)C)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C(C)C)C(=O)NCC(=O)N[C@@]([H])(CCSC)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C39H67N13O12S/c1-20(2)31(50-34(59)26-11-7-14-51(26)29(56)19-46-35(60)30(40)22(4)53)36(61)45-18-28(55)48-23(12-16-65-5)37(62)52-15-8-10-25(52)33(58)44-17-27(54)47-21(3)32(57)49-24(38(63)64)9-6-13-43-39(41)42/h20-26,30-31,53H,6-19,40H2,1-5H3,(H,44,58)(H,45,61)(H,46,60)(H,47,54)(H,48,55)(H,49,57)(H,50,59)(H,63,64)(H4,41,42,43)/t21-,22+,23-,24-,25-,26-,30-,31-/m0/s1 InChIKey=FBQARWGZLMHHDI-QQXYCZKTSA-N |
| Database reference: |