BIOPEP-UWM: Report
| ID | 11289 |
| Name | Tyrosinase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Tyrosinase (EC 1.14.18.1) | |||
| Number of residues | 10 |
Activity code | tyr |
| Activity : | tyrosinase inhibitor |
|||
| Chemical mass | 969.0077 | Monoisotopic mass | 968.4661 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang R., Li Y., Li Y., Zhang H. | |
| Title | |
| Discovering potential anti‑skin‑aging peptides in collagen: computer‑assisted rapid screening and structure–activity relationships. Collagen and Leather, 7, 30, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)O)C(=O)NCC(=O)N[C@@]([H])(C)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCCN)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C39H64N14O15/c1-20(48-27(54)17-45-32(61)21(41)15-30(57)58)37(66)53-14-6-9-25(53)35(64)47-19-29(56)52-13-5-10-26(52)36(65)50-22(7-2-3-11-40)33(62)46-18-28(55)49-24(16-31(59)60)34(63)51-23(38(67)68)8-4-12-44-39(42)43/h20-26H,2-19,40-41H2,1H3,(H,45,61)(H,46,62)(H,47,64)(H,48,54)(H,49,55)(H,50,65)(H,51,63)(H,57,58)(H,59,60)(H,67,68)(H4,42,43,44)/t20-,21-,22-,23-,24-,25-,26-/m0/s1 InChIKey=UGTAYKKWDGDVGI-OLDNPOFQSA-N Inhibitor of Microbial collagenase (EC 3.4.24.3; MEROPS ID: M09.002) according to the BIOPEP-UWM database of bioactive peptides |
| Database reference: |