BIOPEP-UWM: Report
| ID | 11298 |
| Name | Hyaluronidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Hyaluronidase (EC 3.2.1.35) | |||
| Number of residues | 8 |
Activity code | hyal |
| Activity : | Hyaluronidase inhibitor |
|||
| Chemical mass | 1030.1764 | Monoisotopic mass | 1029.5380 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang R., Li Y., Li Y., Zhang H. | |
| Title | |
| Discovering potential anti‑skin‑aging peptides in collagen: computer‑assisted rapid screening and structure–activity relationships. Collagen and Leather, 7, 30, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)NCC(=O)N[C@@]([H])(CCC(=O)O)C(=O)O InChI=1S/C50H71N13O11/c1-29(2)43(63-48(71)40(24-32-26-54-28-57-32)61-46(69)36(17-9-11-21-52)59-44(67)34(53)15-8-10-20-51)49(72)62-39(23-31-25-55-35-16-7-6-14-33(31)35)47(70)60-38(22-30-12-4-3-5-13-30)45(68)56-27-41(64)58-37(50(73)74)18-19-42(65)66/h3-7,12-14,16,25-26,28-29,34,36-40,43,55H,8-11,15,17-24,27,51-53H2,1-2H3,(H,54,57)(H,56,68)(H,58,64)(H,59,67)(H,60,70)(H,61,69)(H,62,72)(H,63,71)(H,65,66)(H,73,74)/t34-,36-,37-,38-,39-,40-,43-/m0/s1 InChIKey=NJXUYJWYDKSTNR-UKFJEHEXSA-N Inhibitor of Microbial collagenase (EC 3.4.24.3; MEROPS ID: M09.002) according to the BIOPEP-UWM database of bioactive peptides Inhibitor of Tyrosinase (EC 1.14.18.1) according to the BIOPEP-UWM database of bioactive peptides |
| Database reference: |