BIOPEP-UWM: Report
| ID | 11309 |
| Name | Anti-inflammatory peptide |
| sequence |
| Function: | |||
| Anti-inflammatory | |||
| Number of residues | 13 |
Activity code | ai |
| Activity : | anti inflammatory |
|||
| Chemical mass | 1392.5971 | Monoisotopic mass | 1391.7538 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wang W., Qi Liang Q., Zhao B., Song X. | |
| Title | |
| Combining bioinformatics techniques to study the anti-inflammatory activity of two novel peptides from yak milk cheese. Food Res. Int., 219, 16995, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C65H101N17O17/c1-35(2)31-42(75-61(95)53(37(5)6)78-59(93)46-20-13-29-81(46)62(96)41(23-25-51(86)87)74-54(88)39(66)22-24-48(67)83)56(90)72-34-50(85)80-28-12-19-45(80)58(92)77-52(36(3)4)60(94)73-40(17-10-26-70-65(68)69)55(89)71-33-49(84)79-27-11-18-44(79)57(91)76-43(32-38-15-8-7-9-16-38)63(97)82-30-14-21-47(82)64(98)99/h7-9,15-16,35-37,39-47,52-53H,10-14,17-34,66H2,1-6H3,(H2,67,83)(H,71,89)(H,72,90)(H,73,94)(H,74,88)(H,75,95)(H,76,91)(H,77,92)(H,78,93)(H,86,87)(H,98,99)(H4,68,69,70)/t39-,40-,41-,42-,43-,44-,45-,46-,47-,52-,53-/m0/s1 InChIKey=KKOYZHWRMWZDPF-BTIVZSCPSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the BIOPEP-UWM database of bioactive peptides (ID 9379); the DFBP database Ameliorating high-glucose-induced insulin resistance in HepG2 cells according to the BIOPEP-UWM database of bioactive peptides (ID 9686) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 9379; 9686 DFBP: ID DFBPACEI1130 Peptipedia: ID 2510509 |