BIOPEP-UWM: Report
| ID | 11322 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 5 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 624.7520 | Monoisotopic mass | 624.3044 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Li Y., Zhao W., Dong L., Xiang K., Ma J., Cong H., Yu B. | |
| Title | |
| Synthetic α-glucosidase inhibitory peptides designed by molecular docking: In vitro screening and anti-hyperglycemic efficacy in diabetic mice. Eur. J. Med. Chem., 302, 118378, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CS)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O InChI=1S/C27H44N8O7S/c1-4-14(2)21(25(40)34-20(26(41)42)12-16-7-9-17(36)10-8-16)35-24(39)19(6-5-11-31-27(29)30)33-22(37)15(3)32-23(38)18(28)13-43/h7-10,14-15,18-21,36,43H,4-6,11-13,28H2,1-3H3,(H,32,38)(H,33,37)(H,34,40)(H,35,39)(H,41,42)(H4,29,30,31)/t14-,15-,18-,19-,20-,21-/m0/s1 InChIKey=NIWGFEUDLZSLIZ-XRYUJSLGSA-N Antidiabetic peptide according to the BIOPEP-UWM database of bioactive peptides |
| Database reference: |