BIOPEP-UWM: Report
| ID | 11325 |
| Name | Antidiabetic peptide |
| sequence |
| Function: | |||
| Lowering glucose content in blood in mice | |||
| Number of residues | 5 |
Activity code | adb |
| Activity : | antidiabetic |
|||
| Chemical mass | 697.8043 | Monoisotopic mass | 697.2997 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Li Y., Zhao W., Dong L., Xiang K., Ma J., Cong H., Yu B. | |
| Title | |
| Synthetic α-glucosidase inhibitory peptides designed by molecular docking: In vitro screening and anti-hyperglycemic efficacy in diabetic mice. Eur. J. Med. Chem., 302, 118378, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CS)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O InChI=1S/C32H43N9O7S/c1-17(38-28(44)22(33)16-49)27(43)39-24(7-4-12-36-32(34)35)29(45)40-25(14-19-15-37-23-6-3-2-5-21(19)23)30(46)41-26(31(47)48)13-18-8-10-20(42)11-9-18/h2-3,5-6,8-11,15,17,22,24-26,37,42,49H,4,7,12-14,16,33H2,1H3,(H,38,44)(H,39,43)(H,40,45)(H,41,46)(H,47,48)(H4,34,35,36)/t17-,22-,24-,25-,26-/m0/s1 InChIKey=QEMXNZDRSFFPAK-KQUHQIRHSA-N Inhibitor of alpha-glucosidase (EC 3.2.1.20) according to the BIOPEP-UWM database of bioactive peptides |
| Database reference: |