BIOPEP-UWM: Report
| ID | 11326 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 4 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 640.7320 | Monoisotopic mass | 640.3436 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Yang W., Hu X., Zhang T., Zhao M., Li Q., Sang M., Fan J., Zhao Y., Zhang B. | |
| Title | |
| Discovery and mechanistic insights into ACE inhibitory peptides from the gastrointestinal digest of royal jelly proteins: peptidomics, bioactivity profiling, in silico screening, and in vitro validation. Food Res. Int., 229, 118476, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C30H44N10O6/c31-21(16-18-6-2-1-3-7-18)25(42)38-22(8-4-14-36-29(32)33)26(43)40-24(17-19-10-12-20(41)13-11-19)27(44)39-23(28(45)46)9-5-15-37-30(34)35/h1-3,6-7,10-13,21-24,41H,4-5,8-9,14-17,31H2,(H,38,42)(H,39,44)(H,40,43)(H,45,46)(H4,32,33,36)(H4,34,35,37)/t21-,22-,23-,24-/m0/s1 InChIKey=NHYAGLMJUXMXAF-ZJZGAYNASA-N |
| Database reference: |