BIOPEP-UWM: Report
| ID | 11328 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 8 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 890.8433 | Monoisotopic mass | 890.3491 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Mendoza-Barajas U. A., Vázquez-Ontiveros M. E., Félix-Medina J. V., Velarde-Barraza R., Grimaldi-Olivas J. C., Badilla-Medina C. N., Amillano-Cisneros J. M., Quintero-Soto M. F. | |
| Title | |
| Systematic purification of peptides with in vitro antioxidant, antihyperglycemic, anti-obesity, and antidiabetic potential released from sesame byproduct proteins. Nutraceuticals, 5, 23, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)NCC(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O InChI=1S/C35H54N8O19/c1-15(2)28(36)34(60)38-16(3)29(55)40-19(6-11-25(49)50)32(58)41-17(4-9-23(45)46)30(56)37-14-22(44)39-18(5-10-24(47)48)31(57)42-20(7-12-26(51)52)33(59)43-21(35(61)62)8-13-27(53)54/h15-21,28H,4-14,36H2,1-3H3,(H,37,56)(H,38,60)(H,39,44)(H,40,55)(H,41,58)(H,42,57)(H,43,59)(H,45,46)(H,47,48)(H,49,50)(H,51,52)(H,53,54)(H,61,62)/t16-,17-,18-,19-,20-,21-,28-/m0/s1 InChIKey=ZNCZMOREACPPQH-QNZZHOLJSA-N |
| Database reference: |